C14H18F2N4O — CID 5406234
N-[(Z)-(3,4-difluorophenyl)methylideneamino]-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 5406234) has the molecular formula C14H18F2N4O and a molecular weight of 296.32 g/mol. Its IUPAC name is N-[(Z)-(3,4-difluorophenyl)methylideneamino]-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-[(Z)-(3,4-difluorophenyl)methylideneamino]-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 5406234 |
| Molecular Formula | C14H18F2N4O |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-[(Z)-(3,4-difluorophenyl)methylideneamino]-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | CN1CCN(CC(=O)N/N=C\c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C14H18F2N4O/c1-19-4-6-20(7-5-19)10-14(21)18-17-9-11-2-3-12(15)13(16)8-11/h2-3,8-9H,4-7,10H2,1H3,(H,18,21)/b17-9- |
| InChIKey | OFDMCLUZLXSPPM-MFOYZWKCSA-N |
| XLogP | 0.66 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|