C23H26N4O — CID 6874502
4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]benzamide (PubChem CID 6874502) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]benzamide.
| Compound Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6874502 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]benzamide |
| SMILES | Cc1cc(C)n(Cc2ccc(C(=O)N/N=C/c3ccc(C(C)C)cc3)cc2)n1 |
| InChI | InChI=1S/C23H26N4O/c1-16(2)21-9-5-19(6-10-21)14-24-25-23(28)22-11-7-20(8-12-22)15-27-18(4)13-17(3)26-27/h5-14,16H,15H2,1-4H3,(H,25,28)/b24-14+ |
| InChIKey | QWMLPGCMOPJHLP-ZVHZXABRSA-N |
| XLogP | 4.44 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|