C20H20N4O3 — CID 135533865
N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-4-[(3,5-dimethylpyrazol-1-yl)methyl]benzamide (PubChem CID 135533865) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-4-[(3,5-dimethylpyrazol-1-yl)methyl]benzamide.
| Compound Name | N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-4-[(3,5-dimethylpyrazol-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 135533865 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-4-[(3,5-dimethylpyrazol-1-yl)methyl]benzamide |
| SMILES | Cc1cc(C)n(Cc2ccc(C(=O)N/N=C/c3ccc(O)cc3O)cc2)n1 |
| InChI | InChI=1S/C20H20N4O3/c1-13-9-14(2)24(23-13)12-15-3-5-16(6-4-15)20(27)22-21-11-17-7-8-18(25)10-19(17)26/h3-11,25-26H,12H2,1-2H3,(H,22,27)/b21-11+ |
| InChIKey | RFPDYUGBFWMTDR-SRZZPIQSSA-N |
| XLogP | 2.72 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|