C20H19N5O3 — CID 6253764
4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(Z)-(3-nitrophenyl)methylideneamino]benzamide (PubChem CID 6253764) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(Z)-(3-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(Z)-(3-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6253764 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(Z)-(3-nitrophenyl)methylideneamino]benzamide |
| SMILES | Cc1cc(C)n(Cc2ccc(C(=O)N/N=C\c3cccc([N+](=O)[O-])c3)cc2)n1 |
| InChI | InChI=1S/C20H19N5O3/c1-14-10-15(2)24(23-14)13-16-6-8-18(9-7-16)20(26)22-21-12-17-4-3-5-19(11-17)25(27)28/h3-12H,13H2,1-2H3,(H,22,26)/b21-12- |
| InChIKey | RVCJCIURZSEANC-MTJSOVHGSA-N |
| XLogP | 3.22 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|