C19H19N5O — CID 724393
4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(pyridin-3-ylmethylideneamino)benzamide (PubChem CID 724393) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(pyridin-3-ylmethylideneamino)benzamide.
| Compound Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(pyridin-3-ylmethylideneamino)benzamide |
|---|---|
| PubChem CID | 724393 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(pyridin-3-ylmethylideneamino)benzamide |
| SMILES | Cc1cc(C)n(Cc2ccc(C(=O)NN=Cc3cccnc3)cc2)n1 |
| InChI | InChI=1S/C19H19N5O/c1-14-10-15(2)24(23-14)13-16-5-7-18(8-6-16)19(25)22-21-12-17-4-3-9-20-11-17/h3-12H,13H2,1-2H3,(H,22,25) |
| InChIKey | RFXVKHUDLMBXIG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|