C30H29ClN4O — CID 92851027
N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzamide (PubChem CID 92851027) has the molecular formula C30H29ClN4O and a molecular weight of 497.04 g/mol. Its IUPAC name is N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzamide.
| Compound Name | N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 92851027 |
| Molecular Formula | C30H29ClN4O |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccc(CN3CCc4ccccc4C3)cc2)c(C)n1-c1ccccc1Cl |
| InChI | InChI=1S/C30H29ClN4O/c1-21-17-27(22(2)35(21)29-10-6-5-9-28(29)31)18-32-33-30(36)25-13-11-23(12-14-25)19-34-16-15-24-7-3-4-8-26(24)20-34/h3-14,17-18H,15-16,19-20H2,1-2H3,(H,33,36)/b32-18- |
| InChIKey | CQWUALOFAKYOIV-CAQPMQTCSA-N |
| XLogP | 6.07 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|