C31H31Cl2N5O — CID 98058689
N-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide (PubChem CID 98058689) has the molecular formula C31H31Cl2N5O and a molecular weight of 560.53 g/mol. Its IUPAC name is N-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 98058689 |
| Molecular Formula | C31H31Cl2N5O |
| Molecular Weight | 560.53 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | N-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccc(CN3CCN(c4ccccc4)CC3)cc2)c(C)n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H31Cl2N5O/c1-22-18-26(23(2)38(22)30-13-12-27(32)19-29(30)33)20-34-35-31(39)25-10-8-24(9-11-25)21-36-14-16-37(17-15-36)28-6-4-3-5-7-28/h3-13,18-20H,14-17,21H2,1-2H3,(H,35,39)/b34-20- |
| InChIKey | NYVGGBXFWQBBMS-GXBUFBABSA-N |
| XLogP | 6.49 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.53 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|