C21H19Cl2N3O2 — CID 94838004
N-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-methoxybenzamide (PubChem CID 94838004) has the molecular formula C21H19Cl2N3O2 and a molecular weight of 416.31 g/mol. Its IUPAC name is N-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-methoxybenzamide.
| Compound Name | N-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 94838004 |
| Molecular Formula | C21H19Cl2N3O2 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2cc(C)n(-c3ccc(Cl)cc3Cl)c2C)cc1 |
| InChI | InChI=1S/C21H19Cl2N3O2/c1-13-10-16(14(2)26(13)20-9-6-17(22)11-19(20)23)12-24-25-21(27)15-4-7-18(28-3)8-5-15/h4-12H,1-3H3,(H,25,27)/b24-12- |
| InChIKey | QXBPBQZVCDDBRF-MSXFZWOLSA-N |
| XLogP | 5.17 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|