C25H25Cl2N4O+ — CID 7087978
N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-[(4-phenylpiperazin-1-ium-1-yl)methyl]benzamide (PubChem CID 7087978) has the molecular formula C25H25Cl2N4O+ and a molecular weight of 468.41 g/mol. Its IUPAC name is N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-[(4-phenylpiperazin-1-ium-1-yl)methyl]benzamide.
| Compound Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-[(4-phenylpiperazin-1-ium-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 7087978 |
| Molecular Formula | C25H25Cl2N4O+ |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-[(4-phenylpiperazin-1-ium-1-yl)methyl]benzamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)cc1Cl)c1ccc(C[NH+]2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H24Cl2N4O/c26-22-11-10-21(24(27)16-22)17-28-29-25(32)20-8-6-19(7-9-20)18-30-12-14-31(15-13-30)23-4-2-1-3-5-23/h1-11,16-17H,12-15,18H2,(H,29,32)/p+1/b28-17- |
| InChIKey | ZZOBZXXQXUFFIS-QRQIAZFYSA-O |
| XLogP | 3.66 |
| TPSA | 49.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|