C28H31N4O4+ — CID 7088024
methyl 4-[(Z)-[[4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]benzoyl]hydrazinylidene]methyl]benzoate (PubChem CID 7088024) has the molecular formula C28H31N4O4+ and a molecular weight of 487.58 g/mol. Its IUPAC name is methyl 4-[(Z)-[[4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]benzoyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[[4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]benzoyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 7088024 |
| Molecular Formula | C28H31N4O4+ |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | methyl 4-[(Z)-[[4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]benzoyl]hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N\NC(=O)c2ccc(C[NH+]3CCN(c4ccccc4OC)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H30N4O4/c1-35-26-6-4-3-5-25(26)32-17-15-31(16-18-32)20-22-9-11-23(12-10-22)27(33)30-29-19-21-7-13-24(14-8-21)28(34)36-2/h3-14,19H,15-18,20H2,1-2H3,(H,30,33)/p+1/b29-19- |
| InChIKey | RPOJCVSDSJEWBK-CEUNXORHSA-O |
| XLogP | 2.15 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|