C17H16N2O4 — CID 3669406
methyl 4-[[(2-methoxybenzoyl)hydrazinylidene]methyl]benzoate (PubChem CID 3669406) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is methyl 4-[[(2-methoxybenzoyl)hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[[(2-methoxybenzoyl)hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 3669406 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | methyl 4-[[(2-methoxybenzoyl)hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=NNC(=O)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C17H16N2O4/c1-22-15-6-4-3-5-14(15)16(20)19-18-11-12-7-9-13(10-8-12)17(21)23-2/h3-11H,1-2H3,(H,19,20) |
| InChIKey | MKQYMYJKCVKXIC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|