C22H18N2O5 — CID 162787179
[4-[(E)-[(4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 2-methoxybenzoate (PubChem CID 162787179) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is [4-[(E)-[(4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 2-methoxybenzoate.
| Compound Name | [4-[(E)-[(4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 162787179 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [4-[(E)-[(4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)Oc1ccc(/C=N/NC(=O)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C22H18N2O5/c1-28-20-5-3-2-4-19(20)22(27)29-18-12-6-15(7-13-18)14-23-24-21(26)16-8-10-17(25)11-9-16/h2-14,25H,1H3,(H,24,26)/b23-14+ |
| InChIKey | UJMIQBKCENBASN-OEAKJJBVSA-N |
| XLogP | 3.38 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|