C30H26N2O4 — CID 6116646
[4-[(Z)-[[4-[(4-methylphenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate (PubChem CID 6116646) has the molecular formula C30H26N2O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is [4-[(Z)-[[4-[(4-methylphenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate.
| Compound Name | [4-[(Z)-[[4-[(4-methylphenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 6116646 |
| Molecular Formula | C30H26N2O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | [4-[(Z)-[[4-[(4-methylphenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate |
| SMILES | Cc1ccc(COc2ccc(C(=O)N/N=C\c3ccc(OC(=O)c4ccccc4C)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H26N2O4/c1-21-7-9-24(10-8-21)20-35-26-17-13-25(14-18-26)29(33)32-31-19-23-11-15-27(16-12-23)36-30(34)28-6-4-3-5-22(28)2/h3-19H,20H2,1-2H3,(H,32,33)/b31-19- |
| InChIKey | UWMXJJIEUGMKHC-DXJNIWACSA-N |
| XLogP | 5.87 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|