C29H24N2O4 — CID 45054705
[4-[(E)-[[4-[(4-methylphenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 45054705) has the molecular formula C29H24N2O4 and a molecular weight of 464.52 g/mol. Its IUPAC name is [4-[(E)-[[4-[(4-methylphenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[(E)-[[4-[(4-methylphenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 45054705 |
| Molecular Formula | C29H24N2O4 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | [4-[(E)-[[4-[(4-methylphenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | Cc1ccc(COc2ccc(C(=O)N/N=C/c3ccc(OC(=O)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H24N2O4/c1-21-7-9-23(10-8-21)20-34-26-17-13-24(14-18-26)28(32)31-30-19-22-11-15-27(16-12-22)35-29(33)25-5-3-2-4-6-25/h2-19H,20H2,1H3,(H,31,32)/b30-19+ |
| InChIKey | QVNLXCDCSLLCSI-NDZAJKAJSA-N |
| XLogP | 5.56 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|