C33H26N2O4 — CID 3499826
[4-[[[4-[(4-methylphenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate (PubChem CID 3499826) has the molecular formula C33H26N2O4 and a molecular weight of 514.58 g/mol. Its IUPAC name is [4-[[[4-[(4-methylphenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[[[4-[(4-methylphenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 3499826 |
| Molecular Formula | C33H26N2O4 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | [4-[[[4-[(4-methylphenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
| SMILES | Cc1ccc(COc2ccc(C(=O)NN=Cc3ccc(OC(=O)c4cccc5ccccc45)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H26N2O4/c1-23-9-11-25(12-10-23)22-38-28-19-15-27(16-20-28)32(36)35-34-21-24-13-17-29(18-14-24)39-33(37)31-8-4-6-26-5-2-3-7-30(26)31/h2-21H,22H2,1H3,(H,35,36) |
| InChIKey | VXYITIFPTLRUJR-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|