C20H24N3O2+ — CID 6861760
methyl 4-[(E)-(4-benzylpiperazin-4-ium-1-yl)iminomethyl]benzoate (PubChem CID 6861760) has the molecular formula C20H24N3O2+ and a molecular weight of 338.43 g/mol. Its IUPAC name is methyl 4-[(E)-(4-benzylpiperazin-4-ium-1-yl)iminomethyl]benzoate.
| Compound Name | methyl 4-[(E)-(4-benzylpiperazin-4-ium-1-yl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 6861760 |
| Molecular Formula | C20H24N3O2+ |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | methyl 4-[(E)-(4-benzylpiperazin-4-ium-1-yl)iminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/N2CC[NH+](Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H23N3O2/c1-25-20(24)19-9-7-17(8-10-19)15-21-23-13-11-22(12-14-23)16-18-5-3-2-4-6-18/h2-10,15H,11-14,16H2,1H3/p+1/b21-15+ |
| InChIKey | WNMSSHCEANHRFO-RCCKNPSSSA-O |
| XLogP | 1.21 |
| TPSA | 46.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|