C20H23ClN3+ — CID 6861770
(Z,E)-N-(4-benzylpiperazin-4-ium-1-yl)-2-chloro-3-phenylprop-2-en-1-imine (PubChem CID 6861770) has the molecular formula C20H23ClN3+ and a molecular weight of 340.88 g/mol. Its IUPAC name is (Z,E)-N-(4-benzylpiperazin-4-ium-1-yl)-2-chloro-3-phenylprop-2-en-1-imine.
| Compound Name | (Z,E)-N-(4-benzylpiperazin-4-ium-1-yl)-2-chloro-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 6861770 |
| Molecular Formula | C20H23ClN3+ |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (Z,E)-N-(4-benzylpiperazin-4-ium-1-yl)-2-chloro-3-phenylprop-2-en-1-imine |
| SMILES | ClC(/C=N\N1CC[NH+](Cc2ccccc2)CC1)=C/c1ccccc1 |
| InChI | InChI=1S/C20H22ClN3/c21-20(15-18-7-3-1-4-8-18)16-22-24-13-11-23(12-14-24)17-19-9-5-2-6-10-19/h1-10,15-16H,11-14,17H2/p+1/b20-15+,22-16- |
| InChIKey | QKKCESWVVGBVCJ-OHEWCHTRSA-O |
| XLogP | 2.65 |
| TPSA | 20.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|