C24H25ClN3+ — CID 6887514
(Z,E)-2-chloro-N-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-3-phenylprop-2-en-1-imine (PubChem CID 6887514) has the molecular formula C24H25ClN3+ and a molecular weight of 390.94 g/mol. Its IUPAC name is (Z,E)-2-chloro-N-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-3-phenylprop-2-en-1-imine.
| Compound Name | (Z,E)-2-chloro-N-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 6887514 |
| Molecular Formula | C24H25ClN3+ |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (Z,E)-2-chloro-N-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-3-phenylprop-2-en-1-imine |
| SMILES | ClC(/C=N\N1CC[NH+](Cc2cccc3ccccc23)CC1)=C/c1ccccc1 |
| InChI | InChI=1S/C24H24ClN3/c25-23(17-20-7-2-1-3-8-20)18-26-28-15-13-27(14-16-28)19-22-11-6-10-21-9-4-5-12-24(21)22/h1-12,17-18H,13-16,19H2/p+1/b23-17+,26-18- |
| InChIKey | UDYPPZIJZOYFEZ-BJNVVXQISA-O |
| XLogP | 3.81 |
| TPSA | 20.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|