C20H21Cl2N3 — CID 6861821
(E,Z)-2-chloro-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine (PubChem CID 6861821) has the molecular formula C20H21Cl2N3 and a molecular weight of 374.32 g/mol. Its IUPAC name is (E,Z)-2-chloro-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine.
| Compound Name | (E,Z)-2-chloro-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 6861821 |
| Molecular Formula | C20H21Cl2N3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (E,Z)-2-chloro-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine |
| SMILES | ClC(=C\c1ccccc1)/C=N/N1CCN(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H21Cl2N3/c21-19(14-17-6-2-1-3-7-17)15-23-25-12-10-24(11-13-25)16-18-8-4-5-9-20(18)22/h1-9,14-15H,10-13,16H2/b19-14-,23-15+ |
| InChIKey | UCTUKMAOYUINRI-ONRFTTIKSA-N |
| XLogP | 4.72 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|