C21H24ClN3 — CID 6861828
(E,E)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-2-methyl-3-phenylprop-2-en-1-imine (PubChem CID 6861828) has the molecular formula C21H24ClN3 and a molecular weight of 353.90 g/mol. Its IUPAC name is (E,E)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-2-methyl-3-phenylprop-2-en-1-imine.
| Compound Name | (E,E)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-2-methyl-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 6861828 |
| Molecular Formula | C21H24ClN3 |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (E,E)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-2-methyl-3-phenylprop-2-en-1-imine |
| SMILES | CC(/C=N/N1CCN(Cc2ccccc2Cl)CC1)=C\c1ccccc1 |
| InChI | InChI=1S/C21H24ClN3/c1-18(15-19-7-3-2-4-8-19)16-23-25-13-11-24(12-14-25)17-20-9-5-6-10-21(20)22/h2-10,15-16H,11-14,17H2,1H3/b18-15+,23-16+ |
| InChIKey | KWVXTUBVGIUVEN-WINQIOIRSA-N |
| XLogP | 4.55 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|