C17H19Cl2N4- — CID 53347686
N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-1-pyridin-4-ylmethanimine chloride (PubChem CID 53347686) has the molecular formula C17H19Cl2N4- and a molecular weight of 350.27 g/mol. Its IUPAC name is N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-1-pyridin-4-ylmethanimine chloride.
| Compound Name | N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-1-pyridin-4-ylmethanimine chloride |
|---|---|
| PubChem CID | 53347686 |
| Molecular Formula | C17H19Cl2N4- |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-1-pyridin-4-ylmethanimine chloride |
| SMILES | Clc1ccccc1CN1CCN(N=Cc2ccncc2)CC1.[Cl-] |
| InChI | InChI=1S/C17H19ClN4.ClH/c18-17-4-2-1-3-16(17)14-21-9-11-22(12-10-21)20-13-15-5-7-19-8-6-15;/h1-8,13H,9-12,14H2;1H/p-1 |
| InChIKey | IHILYEFMFFLIOI-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|