C18H19Cl3FN3 — CID 45045654
(E)-1-(2-chloro-6-fluorophenyl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine;hydrochloride (PubChem CID 45045654) has the molecular formula C18H19Cl3FN3 and a molecular weight of 402.73 g/mol. Its IUPAC name is (E)-1-(2-chloro-6-fluorophenyl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine;hydrochloride.
| Compound Name | (E)-1-(2-chloro-6-fluorophenyl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine;hydrochloride |
|---|---|
| PubChem CID | 45045654 |
| Molecular Formula | C18H19Cl3FN3 |
| Molecular Weight | 402.73 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | (E)-1-(2-chloro-6-fluorophenyl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine;hydrochloride |
| SMILES | Cl.Fc1cccc(Cl)c1/C=N/N1CCN(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H18Cl2FN3.ClH/c19-16-5-2-1-4-14(16)13-23-8-10-24(11-9-23)22-12-15-17(20)6-3-7-18(15)21;/h1-7,12H,8-11,13H2;1H/b22-12+; |
| InChIKey | DNOVJXKEASZALY-RSRKELGKSA-N |
| XLogP | 4.71 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.73 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|