C18H19ClFN3 — CID 869953
N-(4-benzylpiperazin-1-yl)-1-(2-chloro-6-fluorophenyl)methanimine (PubChem CID 869953) has the molecular formula C18H19ClFN3 and a molecular weight of 331.82 g/mol. Its IUPAC name is N-(4-benzylpiperazin-1-yl)-1-(2-chloro-6-fluorophenyl)methanimine.
| Compound Name | N-(4-benzylpiperazin-1-yl)-1-(2-chloro-6-fluorophenyl)methanimine |
|---|---|
| PubChem CID | 869953 |
| Molecular Formula | C18H19ClFN3 |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-(4-benzylpiperazin-1-yl)-1-(2-chloro-6-fluorophenyl)methanimine |
| SMILES | Fc1cccc(Cl)c1C=NN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H19ClFN3/c19-17-7-4-8-18(20)16(17)13-21-23-11-9-22(10-12-23)14-15-5-2-1-3-6-15/h1-8,13H,9-12,14H2 |
| InChIKey | XKYIQJRBGVWJGF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|