C22H24ClN5 — CID 2322272
N-(4-benzylpiperazin-1-yl)-1-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methanimine (PubChem CID 2322272) has the molecular formula C22H24ClN5 and a molecular weight of 393.92 g/mol. Its IUPAC name is N-(4-benzylpiperazin-1-yl)-1-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methanimine.
| Compound Name | N-(4-benzylpiperazin-1-yl)-1-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methanimine |
|---|---|
| PubChem CID | 2322272 |
| Molecular Formula | C22H24ClN5 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-(4-benzylpiperazin-1-yl)-1-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methanimine |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C=NN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H24ClN5/c1-18-21(22(23)28(25-18)20-10-6-3-7-11-20)16-24-27-14-12-26(13-15-27)17-19-8-4-2-5-9-19/h2-11,16H,12-15,17H2,1H3 |
| InChIKey | ODOOYRXEBHUWCY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|