C18H23ClN4 — CID 3319538
1-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-N-(2,6-dimethylpiperidin-1-yl)methanimine (PubChem CID 3319538) has the molecular formula C18H23ClN4 and a molecular weight of 330.86 g/mol. Its IUPAC name is 1-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-N-(2,6-dimethylpiperidin-1-yl)methanimine.
| Compound Name | 1-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-N-(2,6-dimethylpiperidin-1-yl)methanimine |
|---|---|
| PubChem CID | 3319538 |
| Molecular Formula | C18H23ClN4 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-N-(2,6-dimethylpiperidin-1-yl)methanimine |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C=NN1C(C)CCCC1C |
| InChI | InChI=1S/C18H23ClN4/c1-13-8-7-9-14(2)22(13)20-12-17-15(3)21-23(18(17)19)16-10-5-4-6-11-16/h4-6,10-14H,7-9H2,1-3H3 |
| InChIKey | JQAAFLFHSFSORD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|