C21H25ClN4 — CID 8005097
(Z,1S,4S)-N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine (PubChem CID 8005097) has the molecular formula C21H25ClN4 and a molecular weight of 368.91 g/mol. Its IUPAC name is (Z,1S,4S)-N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine.
| Compound Name | (Z,1S,4S)-N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 8005097 |
| Molecular Formula | C21H25ClN4 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | (Z,1S,4S)-N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=N\N=C1\C[C@@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C21H25ClN4/c1-14-17(19(22)26(25-14)16-8-6-5-7-9-16)13-23-24-18-12-15-10-11-21(18,4)20(15,2)3/h5-9,13,15H,10-12H2,1-4H3/b23-13-,24-18-/t15-,21+/m0/s1 |
| InChIKey | QMGWPHKTOVSBIY-KXBAPAOMSA-N |
| XLogP | 5.46 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|