C17H21N3O2 — CID 9113913
(Z,1R,4R)-1,7,7-trimethyl-N-[(Z)-(4-nitrophenyl)methylideneamino]bicyclo[2.2.1]heptan-2-imine (PubChem CID 9113913) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is (Z,1R,4R)-1,7,7-trimethyl-N-[(Z)-(4-nitrophenyl)methylideneamino]bicyclo[2.2.1]heptan-2-imine.
| Compound Name | (Z,1R,4R)-1,7,7-trimethyl-N-[(Z)-(4-nitrophenyl)methylideneamino]bicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 9113913 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | (Z,1R,4R)-1,7,7-trimethyl-N-[(Z)-(4-nitrophenyl)methylideneamino]bicyclo[2.2.1]heptan-2-imine |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)/C(=N/N=C\c1ccc([N+](=O)[O-])cc1)C2 |
| InChI | InChI=1S/C17H21N3O2/c1-16(2)13-8-9-17(16,3)15(10-13)19-18-11-12-4-6-14(7-5-12)20(21)22/h4-7,11,13H,8-10H2,1-3H3/b18-11-,19-15+/t13-,17+/m1/s1 |
| InChIKey | FNVVIQLZNUBUCJ-ZBTNNIPRSA-N |
| XLogP | 4.22 |
| TPSA | 67.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|