C19H24N2O2 — CID 98137043
1-(4-nitrophenyl)-N-[[(1S,8S)-3-tricyclo[4.3.1.13,8]undecanyl]methyl]methanimine (PubChem CID 98137043) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-N-[[(1S,8S)-3-tricyclo[4.3.1.13,8]undecanyl]methyl]methanimine.
| Compound Name | 1-(4-nitrophenyl)-N-[[(1S,8S)-3-tricyclo[4.3.1.13,8]undecanyl]methyl]methanimine |
|---|---|
| PubChem CID | 98137043 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-(4-nitrophenyl)-N-[[(1S,8S)-3-tricyclo[4.3.1.13,8]undecanyl]methyl]methanimine |
| SMILES | O=[N+]([O-])c1ccc(/C=N/CC23CCC4C[C@@H](C[C@H](C4)C2)C3)cc1 |
| InChI | InChI=1S/C19H24N2O2/c22-21(23)18-3-1-14(2-4-18)12-20-13-19-6-5-15-7-16(10-19)9-17(8-15)11-19/h1-4,12,15-17H,5-11,13H2/b20-12+/t15?,16-,17-,19?/m0/s1 |
| InChIKey | BVQAVWXDZWXYQC-HJYBFWLZSA-N |
| XLogP | 4.62 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|