C18H22N2O3 — CID 3990801
2-(1-adamantylmethyliminomethyl)-4-nitrophenol (PubChem CID 3990801) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-(1-adamantylmethyliminomethyl)-4-nitrophenol.
| Compound Name | 2-(1-adamantylmethyliminomethyl)-4-nitrophenol |
|---|---|
| PubChem CID | 3990801 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-(1-adamantylmethyliminomethyl)-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(/C=N/CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C18H22N2O3/c21-17-2-1-16(20(22)23)6-15(17)10-19-11-18-7-12-3-13(8-18)5-14(4-12)9-18/h1-2,6,10,12-14,21H,3-5,7-9,11H2/b19-10+ |
| InChIKey | RUTHJMXVFKPVOT-VXLYETTFSA-N |
| XLogP | 3.94 |
| TPSA | 75.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|