C16H14F6MnN4O6P- — CID 139264621
2-[2-[(2-hydroxy-5-nitrophenyl)methylideneamino]ethyliminomethyl]-4-nitrophenol;manganese;hexafluorophosphate (PubChem CID 139264621) has the molecular formula C16H14F6MnN4O6P- and a molecular weight of 558.21 g/mol. Its IUPAC name is 2-[2-[(2-hydroxy-5-nitrophenyl)methylideneamino]ethyliminomethyl]-4-nitrophenol;manganese;hexafluorophosphate.
| Compound Name | 2-[2-[(2-hydroxy-5-nitrophenyl)methylideneamino]ethyliminomethyl]-4-nitrophenol;manganese;hexafluorophosphate |
|---|---|
| PubChem CID | 139264621 |
| Molecular Formula | C16H14F6MnN4O6P- |
| Molecular Weight | 558.21 g/mol |
| Exact Mass | 557.99 |
| IUPAC Name | 2-[2-[(2-hydroxy-5-nitrophenyl)methylideneamino]ethyliminomethyl]-4-nitrophenol;manganese;hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.O=[N+]([O-])c1ccc(O)c(/C=N/CC/N=C/c2cc([N+](=O)[O-])ccc2O)c1.[Mn] |
| InChI | InChI=1S/C16H14N4O6.F6P.Mn/c21-15-3-1-13(19(23)24)7-11(15)9-17-5-6-18-10-12-8-14(20(25)26)2-4-16(12)22;1-7(2,3,4,5)6;/h1-4,7-10,21-22H,5-6H2;;/q;-1;/b17-9+,18-10+;; |
| InChIKey | SFHRHRRVGZDCTN-CKNTWHFTSA-N |
| XLogP | 5.83 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.21 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|