About iron(3+);bis(2-[2-(methylamino)ethyliminomethyl]-4-nitrophenol)
iron(3+);bis(2-[2-(methylamino)ethyliminomethyl]-4-nitrophenol) (PubChem CID 135459871) has the molecular formula C20H26FeN6O6+3
and a molecular weight of 502.31 g/mol. Its IUPAC name is iron(3+);bis(2-[2-(methylamino)ethyliminomethyl]-4-nitrophenol).
Molecular Properties
| Compound Name | iron(3+);bis(2-[2-(methylamino)ethyliminomethyl]-4-nitrophenol) |
| PubChem CID | 135459871 |
| Molecular Formula | C20H26FeN6O6+3 |
| Molecular Weight | 502.31 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | iron(3+);bis(2-[2-(methylamino)ethyliminomethyl]-4-nitrophenol) |
| SMILES | CNCC/N=C/c1cc([N+](=O)[O-])ccc1O.CNCC/N=C/c1cc([N+](=O)[O-])ccc1O.[Fe+3] |
| InChI | InChI=1S/2C10H13N3O3.Fe/c2*1-11-4-5-12-7-8-6-9(13(15)16)2-3-10(8)14;/h2*2-3,6-7,11,14H,4-5H2,1H3;/q;;+3/b2*12-7+; |
| InChIKey | QLVKWUPPMONNDI-PZNGMHCYSA-N |
| XLogP | 1.87 |
| TPSA | 175.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 502.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze iron(3+);bis(2-[2-(methylamino)ethyliminomethyl]-4-nitrophenol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(3+);bis(2-[2-(methylamino)ethyliminomethyl]-4-nitrophenol)?
The IUPAC name of iron(3+);bis(2-[2-(methylamino)ethyliminomethyl]-4-nitrophenol) (CID 135459871) is iron(3+);bis(2-[2-(methylamino)ethyliminomethyl]-4-nitrophenol).
What is the SMILES notation for iron(3+);bis(2-[2-(methylamino)ethyliminomethyl]-4-nitrophenol)?
The canonical SMILES for iron(3+);bis(2-[2-(methylamino)ethyliminomethyl]-4-nitrophenol) is CNCC/N=C/c1cc([N+](=O)[O-])ccc1O.CNCC/N=C/c1cc([N+](=O)[O-])ccc1O.[Fe+3].
What is the InChIKey of iron(3+);bis(2-[2-(methylamino)ethyliminomethyl]-4-nitrophenol)?
The InChIKey is QLVKWUPPMONNDI-PZNGMHCYSA-N. The full InChI is InChI=1S/2C10H13N3O3.Fe/c2*1-11-4-5-12-7-8-6-9(13(15)16)2-3-10(8)14;/h2*2-3,6-7,11,14H,4-5H2,1H3;/q;;+3/b2*12-7+;.
What are the key properties of iron(3+);bis(2-[2-(methylamino)ethyliminomethyl]-4-nitrophenol)?
iron(3+);bis(2-[2-(methylamino)ethyliminomethyl]-4-nitrophenol) has a molecular weight of 502.31 g/mol, XLogP of 1.87, 10 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for iron(3+);bis(2-[2-(methylamino)ethyliminomethyl]-4-nitrophenol) is sourced from PubChem (CID 135459871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).