C20H22N4O8 — CID 135496238
2-[[(2S,3S)-3-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,4-dimethoxybutan-2-yl]iminomethyl]-4-nitrophenol (PubChem CID 135496238) has the molecular formula C20H22N4O8 and a molecular weight of 446.42 g/mol. Its IUPAC name is 2-[[(2S,3S)-3-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,4-dimethoxybutan-2-yl]iminomethyl]-4-nitrophenol.
| Compound Name | 2-[[(2S,3S)-3-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,4-dimethoxybutan-2-yl]iminomethyl]-4-nitrophenol |
|---|---|
| PubChem CID | 135496238 |
| Molecular Formula | C20H22N4O8 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 2-[[(2S,3S)-3-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,4-dimethoxybutan-2-yl]iminomethyl]-4-nitrophenol |
| SMILES | COC[C@@H](/N=C/c1cc([N+](=O)[O-])ccc1O)[C@@H](COC)/N=C/c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C20H22N4O8/c1-31-11-17(21-9-13-7-15(23(27)28)3-5-19(13)25)18(12-32-2)22-10-14-8-16(24(29)30)4-6-20(14)26/h3-10,17-18,25-26H,11-12H2,1-2H3/b21-9+,22-10+/t17-,18-/m1/s1 |
| InChIKey | VNBYUKGREVRCDK-QCRKNGOHSA-N |
| XLogP | 2.48 |
| TPSA | 169.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|