C16H15N3O7 — CID 135619541
(1S,2S)-2-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1-(4-nitrophenyl)propane-1,3-diol (PubChem CID 135619541) has the molecular formula C16H15N3O7 and a molecular weight of 361.31 g/mol. Its IUPAC name is (1S,2S)-2-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1-(4-nitrophenyl)propane-1,3-diol.
| Compound Name | (1S,2S)-2-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1-(4-nitrophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 135619541 |
| Molecular Formula | C16H15N3O7 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (1S,2S)-2-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1-(4-nitrophenyl)propane-1,3-diol |
| SMILES | O=[N+]([O-])c1ccc([C@H](O)[C@H](CO)/N=C/c2cc([N+](=O)[O-])ccc2O)cc1 |
| InChI | InChI=1S/C16H15N3O7/c20-9-14(16(22)10-1-3-12(4-2-10)18(23)24)17-8-11-7-13(19(25)26)5-6-15(11)21/h1-8,14,16,20-22H,9H2/b17-8+/t14-,16-/m0/s1 |
| InChIKey | JRIWDBPNCCULFC-PMTMLVDSSA-N |
| XLogP | 1.72 |
| TPSA | 159.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|