C17H18N2O6 — CID 136742508
(1R,2R)-2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-1-(4-nitrophenyl)propane-1,3-diol (PubChem CID 136742508) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is (1R,2R)-2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-1-(4-nitrophenyl)propane-1,3-diol.
| Compound Name | (1R,2R)-2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-1-(4-nitrophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 136742508 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (1R,2R)-2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-1-(4-nitrophenyl)propane-1,3-diol |
| SMILES | COc1cccc(/C=N/[C@H](CO)[C@H](O)c2ccc([N+](=O)[O-])cc2)c1O |
| InChI | InChI=1S/C17H18N2O6/c1-25-15-4-2-3-12(17(15)22)9-18-14(10-20)16(21)11-5-7-13(8-6-11)19(23)24/h2-9,14,16,20-22H,10H2,1H3/b18-9+/t14-,16-/m1/s1 |
| InChIKey | UWEOHGGBJUDEMP-SHGRGFRKSA-N |
| XLogP | 1.82 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|