C13H19CuNO5 — CID 5255158
copper;2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-3-methylbutanoic acid;hydrate (PubChem CID 5255158) has the molecular formula C13H19CuNO5 and a molecular weight of 332.84 g/mol. Its IUPAC name is copper;2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-3-methylbutanoic acid;hydrate.
| Compound Name | copper;2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-3-methylbutanoic acid;hydrate |
|---|---|
| PubChem CID | 5255158 |
| Molecular Formula | C13H19CuNO5 |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | copper;2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-3-methylbutanoic acid;hydrate |
| SMILES | COc1cccc(/C=N/C(C(=O)O)C(C)C)c1O.O.[Cu] |
| InChI | InChI=1S/C13H17NO4.Cu.H2O/c1-8(2)11(13(16)17)14-7-9-5-4-6-10(18-3)12(9)15;;/h4-8,11,15H,1-3H3,(H,16,17);;1H2/b14-7+;; |
| InChIKey | CEHRFFMQUZWSPR-MOEKMLTRSA-N |
| XLogP | 1.10 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|