C17H20N2O6 — CID 135590546
2-[[2-(2,6-dimethoxyphenyl)-5-hydroxy-1,3-oxazol-4-yl]methylideneamino]-3-methylbutanoic acid (PubChem CID 135590546) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-[[2-(2,6-dimethoxyphenyl)-5-hydroxy-1,3-oxazol-4-yl]methylideneamino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-(2,6-dimethoxyphenyl)-5-hydroxy-1,3-oxazol-4-yl]methylideneamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 135590546 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-[[2-(2,6-dimethoxyphenyl)-5-hydroxy-1,3-oxazol-4-yl]methylideneamino]-3-methylbutanoic acid |
| SMILES | COc1cccc(OC)c1-c1nc(/C=N/C(C(=O)O)C(C)C)c(O)o1 |
| InChI | InChI=1S/C17H20N2O6/c1-9(2)14(16(20)21)18-8-10-17(22)25-15(19-10)13-11(23-3)6-5-7-12(13)24-4/h5-9,14,22H,1-4H3,(H,20,21)/b18-8+ |
| InChIKey | ZZCHVAHIFQEYRH-QGMBQPNBSA-N |
| XLogP | 2.59 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|