C19H19N3O5 — CID 5015995
4-[(6-methyl-2-pyridinyl)iminomethyl]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-ol (PubChem CID 5015995) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is 4-[(6-methyl-2-pyridinyl)iminomethyl]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-ol.
| Compound Name | 4-[(6-methyl-2-pyridinyl)iminomethyl]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 5015995 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 4-[(6-methyl-2-pyridinyl)iminomethyl]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-ol |
| SMILES | COc1cc(-c2nc(C=Nc3cccc(C)n3)c(O)o2)cc(OC)c1OC |
| InChI | InChI=1S/C19H19N3O5/c1-11-6-5-7-16(21-11)20-10-13-19(23)27-18(22-13)12-8-14(24-2)17(26-4)15(9-12)25-3/h5-10,23H,1-4H3 |
| InChIKey | GBYSJAQBCCDZDW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|