C17H12Cl2N2O3 — CID 4642510
2-(5-chloro-2-methoxyphenyl)-4-[(2-chlorophenyl)iminomethyl]-1,3-oxazol-5-ol (PubChem CID 4642510) has the molecular formula C17H12Cl2N2O3 and a molecular weight of 363.20 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-4-[(2-chlorophenyl)iminomethyl]-1,3-oxazol-5-ol.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-4-[(2-chlorophenyl)iminomethyl]-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 4642510 |
| Molecular Formula | C17H12Cl2N2O3 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-4-[(2-chlorophenyl)iminomethyl]-1,3-oxazol-5-ol |
| SMILES | COc1ccc(Cl)cc1-c1nc(/C=N/c2ccccc2Cl)c(O)o1 |
| InChI | InChI=1S/C17H12Cl2N2O3/c1-23-15-7-6-10(18)8-11(15)16-21-14(17(22)24-16)9-20-13-5-3-2-4-12(13)19/h2-9,22H,1H3/b20-9+ |
| InChIKey | MVFNKHKGAIQOGU-AWQFTUOYSA-N |
| XLogP | 5.11 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|