C14H10Cl3NO — CID 4779300
N-(2-chlorophenyl)-1-(3,5-dichloro-2-methoxyphenyl)methanimine (PubChem CID 4779300) has the molecular formula C14H10Cl3NO and a molecular weight of 314.60 g/mol. Its IUPAC name is N-(2-chlorophenyl)-1-(3,5-dichloro-2-methoxyphenyl)methanimine.
| Compound Name | N-(2-chlorophenyl)-1-(3,5-dichloro-2-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 4779300 |
| Molecular Formula | C14H10Cl3NO |
| Molecular Weight | 314.60 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | N-(2-chlorophenyl)-1-(3,5-dichloro-2-methoxyphenyl)methanimine |
| SMILES | COc1c(Cl)cc(Cl)cc1/C=N/c1ccccc1Cl |
| InChI | InChI=1S/C14H10Cl3NO/c1-19-14-9(6-10(15)7-12(14)17)8-18-13-5-3-2-4-11(13)16/h2-8H,1H3/b18-8+ |
| InChIKey | OQIRNTPVPPYFBR-QGMBQPNBSA-N |
| XLogP | 5.41 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|