C20H15ClN2OS2 — CID 135603470
4-chloro-2,6-bis[(2-sulfanylphenyl)iminomethyl]phenol (PubChem CID 135603470) has the molecular formula C20H15ClN2OS2 and a molecular weight of 398.94 g/mol. Its IUPAC name is 4-chloro-2,6-bis[(2-sulfanylphenyl)iminomethyl]phenol.
| Compound Name | 4-chloro-2,6-bis[(2-sulfanylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135603470 |
| Molecular Formula | C20H15ClN2OS2 |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 4-chloro-2,6-bis[(2-sulfanylphenyl)iminomethyl]phenol |
| SMILES | Oc1c(/C=N/c2ccccc2S)cc(Cl)cc1/C=N/c1ccccc1S |
| InChI | InChI=1S/C20H15ClN2OS2/c21-15-9-13(11-22-16-5-1-3-7-18(16)25)20(24)14(10-15)12-23-17-6-2-4-8-19(17)26/h1-12,24-26H/b22-11+,23-12+ |
| InChIKey | DIVYUGIRUFZHHB-LCHFAGMQSA-N |
| XLogP | 6.12 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|