C23H22N2OS2 — CID 136797753
4-methyl-2,6-bis[(2-methylsulfanylphenyl)iminomethyl]phenol (PubChem CID 136797753) has the molecular formula C23H22N2OS2 and a molecular weight of 406.58 g/mol. Its IUPAC name is 4-methyl-2,6-bis[(2-methylsulfanylphenyl)iminomethyl]phenol.
| Compound Name | 4-methyl-2,6-bis[(2-methylsulfanylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 136797753 |
| Molecular Formula | C23H22N2OS2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 4-methyl-2,6-bis[(2-methylsulfanylphenyl)iminomethyl]phenol |
| SMILES | CSc1ccccc1/N=C/c1cc(C)cc(/C=N/c2ccccc2SC)c1O |
| InChI | InChI=1S/C23H22N2OS2/c1-16-12-17(14-24-19-8-4-6-10-21(19)27-2)23(26)18(13-16)15-25-20-9-5-7-11-22(20)28-3/h4-15,26H,1-3H3/b24-14+,25-15+ |
| InChIKey | IZOUFMRXZXNEQR-KOJZRSEWSA-N |
| XLogP | 6.65 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|