C24H27N3OS — CID 136717193
4-methyl-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-6-[(2-methylsulfanylphenyl)iminomethyl]phenol (PubChem CID 136717193) has the molecular formula C24H27N3OS and a molecular weight of 405.57 g/mol. Its IUPAC name is 4-methyl-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-6-[(2-methylsulfanylphenyl)iminomethyl]phenol.
| Compound Name | 4-methyl-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-6-[(2-methylsulfanylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 136717193 |
| Molecular Formula | C24H27N3OS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 4-methyl-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-6-[(2-methylsulfanylphenyl)iminomethyl]phenol |
| SMILES | CSc1ccccc1/N=C/c1cc(C)cc(CN(C)CCc2ccccn2)c1O |
| InChI | InChI=1S/C24H27N3OS/c1-18-14-19(16-26-22-9-4-5-10-23(22)29-3)24(28)20(15-18)17-27(2)13-11-21-8-6-7-12-25-21/h4-10,12,14-16,28H,11,13,17H2,1-3H3/b26-16+ |
| InChIKey | RVRWACKTFVOVMR-WGOQTCKBSA-N |
| XLogP | 5.24 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|