C16H18FN3S — CID 64765776
4-fluoro-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]benzenecarbothioamide (PubChem CID 64765776) has the molecular formula C16H18FN3S and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-fluoro-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]benzenecarbothioamide.
| Compound Name | 4-fluoro-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 64765776 |
| Molecular Formula | C16H18FN3S |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 4-fluoro-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]benzenecarbothioamide |
| SMILES | CN(CCc1ccccn1)Cc1cc(F)ccc1C(N)=S |
| InChI | InChI=1S/C16H18FN3S/c1-20(9-7-14-4-2-3-8-19-14)11-12-10-13(17)5-6-15(12)16(18)21/h2-6,8,10H,7,9,11H2,1H3,(H2,18,21) |
| InChIKey | SXHHDOCJJCDTPS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|