C18H18FN3O — CID 56723183
7-fluoro-3-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1H-quinolin-2-one (PubChem CID 56723183) has the molecular formula C18H18FN3O and a molecular weight of 311.36 g/mol. Its IUPAC name is 7-fluoro-3-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1H-quinolin-2-one.
| Compound Name | 7-fluoro-3-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 56723183 |
| Molecular Formula | C18H18FN3O |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 7-fluoro-3-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1H-quinolin-2-one |
| SMILES | CN(CCc1ccccn1)Cc1cc2ccc(F)cc2[nH]c1=O |
| InChI | InChI=1S/C18H18FN3O/c1-22(9-7-16-4-2-3-8-20-16)12-14-10-13-5-6-15(19)11-17(13)21-18(14)23/h2-6,8,10-11H,7,9,12H2,1H3,(H,21,23) |
| InChIKey | QKHVFDJCEXXRIW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |