C24H29ClN4O — CID 139202506
4-chloro-2,6-bis[[methyl(2-pyridin-2-ylethyl)amino]methyl]phenol (PubChem CID 139202506) has the molecular formula C24H29ClN4O and a molecular weight of 424.98 g/mol. Its IUPAC name is 4-chloro-2,6-bis[[methyl(2-pyridin-2-ylethyl)amino]methyl]phenol.
| Compound Name | 4-chloro-2,6-bis[[methyl(2-pyridin-2-ylethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 139202506 |
| Molecular Formula | C24H29ClN4O |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 4-chloro-2,6-bis[[methyl(2-pyridin-2-ylethyl)amino]methyl]phenol |
| SMILES | CN(CCc1ccccn1)Cc1cc(Cl)cc(CN(C)CCc2ccccn2)c1O |
| InChI | InChI=1S/C24H29ClN4O/c1-28(13-9-22-7-3-5-11-26-22)17-19-15-21(25)16-20(24(19)30)18-29(2)14-10-23-8-4-6-12-27-23/h3-8,11-12,15-16,30H,9-10,13-14,17-18H2,1-2H3 |
| InChIKey | AKRIESVGPFFMCH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|