About copper(1+);bis(N-(2-methylsulfanylphenyl)-1-pyridin-2-ylmethanimine)
copper(1+);bis(N-(2-methylsulfanylphenyl)-1-pyridin-2-ylmethanimine) (PubChem CID 140660307) has the molecular formula C26H24CuN4S2+
and a molecular weight of 520.19 g/mol. Its IUPAC name is copper(1+);bis(N-(2-methylsulfanylphenyl)-1-pyridin-2-ylmethanimine).
Molecular Properties
| Compound Name | copper(1+);bis(N-(2-methylsulfanylphenyl)-1-pyridin-2-ylmethanimine) |
| PubChem CID | 140660307 |
| Molecular Formula | C26H24CuN4S2+ |
| Molecular Weight | 520.19 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | copper(1+);bis(N-(2-methylsulfanylphenyl)-1-pyridin-2-ylmethanimine) |
| SMILES | CSc1ccccc1/N=C/c1ccccn1.CSc1ccccc1/N=C/c1ccccn1.[Cu+] |
| InChI | InChI=1S/2C13H12N2S.Cu/c2*1-16-13-8-3-2-7-12(13)15-10-11-6-4-5-9-14-11;/h2*2-10H,1H3;/q;;+1/b2*15-10+; |
| InChIKey | AUPDFDQJSAIDJD-ZQSWXEMLSA-N |
| XLogP | 7.11 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.19 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);bis(N-(2-methylsulfanylphenyl)-1-pyridin-2-ylmethanimine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);bis(N-(2-methylsulfanylphenyl)-1-pyridin-2-ylmethanimine)?
The IUPAC name of copper(1+);bis(N-(2-methylsulfanylphenyl)-1-pyridin-2-ylmethanimine) (CID 140660307) is copper(1+);bis(N-(2-methylsulfanylphenyl)-1-pyridin-2-ylmethanimine).
What is the SMILES notation for copper(1+);bis(N-(2-methylsulfanylphenyl)-1-pyridin-2-ylmethanimine)?
The canonical SMILES for copper(1+);bis(N-(2-methylsulfanylphenyl)-1-pyridin-2-ylmethanimine) is CSc1ccccc1/N=C/c1ccccn1.CSc1ccccc1/N=C/c1ccccn1.[Cu+].
What is the InChIKey of copper(1+);bis(N-(2-methylsulfanylphenyl)-1-pyridin-2-ylmethanimine)?
The InChIKey is AUPDFDQJSAIDJD-ZQSWXEMLSA-N. The full InChI is InChI=1S/2C13H12N2S.Cu/c2*1-16-13-8-3-2-7-12(13)15-10-11-6-4-5-9-14-11;/h2*2-10H,1H3;/q;;+1/b2*15-10+;.
What are the key properties of copper(1+);bis(N-(2-methylsulfanylphenyl)-1-pyridin-2-ylmethanimine)?
copper(1+);bis(N-(2-methylsulfanylphenyl)-1-pyridin-2-ylmethanimine) has a molecular weight of 520.19 g/mol, XLogP of 7.11, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);bis(N-(2-methylsulfanylphenyl)-1-pyridin-2-ylmethanimine) is sourced from PubChem (CID 140660307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).