C30H25N7 — CID 102340427
1-pyridin-2-yl-N,N'-bis[2-(pyridin-2-ylmethylideneamino)phenyl]methanediamine (PubChem CID 102340427) has the molecular formula C30H25N7 and a molecular weight of 483.58 g/mol. Its IUPAC name is 1-pyridin-2-yl-N,N'-bis[2-(pyridin-2-ylmethylideneamino)phenyl]methanediamine.
| Compound Name | 1-pyridin-2-yl-N,N'-bis[2-(pyridin-2-ylmethylideneamino)phenyl]methanediamine |
|---|---|
| PubChem CID | 102340427 |
| Molecular Formula | C30H25N7 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 1-pyridin-2-yl-N,N'-bis[2-(pyridin-2-ylmethylideneamino)phenyl]methanediamine |
| SMILES | C(=N/c1ccccc1NC(Nc1ccccc1/N=C/c1ccccn1)c1ccccn1)\c1ccccn1 |
| InChI | InChI=1S/C30H25N7/c1-3-15-27(25(13-1)34-21-23-11-5-8-18-31-23)36-30(29-17-7-10-20-33-29)37-28-16-4-2-14-26(28)35-22-24-12-6-9-19-32-24/h1-22,30,36-37H/b34-21+,35-22+ |
| InChIKey | XSLMJFMCVXQASV-TWOPAUOSSA-N |
| XLogP | 6.60 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|