C17H21Cl2N5Zn — CID 175684000
dichlorozinc;1,1,3,3-tetramethyl-2-[2-(pyridin-2-ylmethylideneamino)phenyl]guanidine (PubChem CID 175684000) has the molecular formula C17H21Cl2N5Zn and a molecular weight of 431.69 g/mol. Its IUPAC name is dichlorozinc;1,1,3,3-tetramethyl-2-[2-(pyridin-2-ylmethylideneamino)phenyl]guanidine.
| Compound Name | dichlorozinc;1,1,3,3-tetramethyl-2-[2-(pyridin-2-ylmethylideneamino)phenyl]guanidine |
|---|---|
| PubChem CID | 175684000 |
| Molecular Formula | C17H21Cl2N5Zn |
| Molecular Weight | 431.69 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | dichlorozinc;1,1,3,3-tetramethyl-2-[2-(pyridin-2-ylmethylideneamino)phenyl]guanidine |
| SMILES | CN(C)C(=Nc1ccccc1/N=C/c1ccccn1)N(C)C.Cl[Zn]Cl |
| InChI | InChI=1S/C17H21N5.2ClH.Zn/c1-21(2)17(22(3)4)20-16-11-6-5-10-15(16)19-13-14-9-7-8-12-18-14;;;/h5-13H,1-4H3;2*1H;/q;;;+2/p-2/b19-13+;;; |
| InChIKey | LVKRSCJWBOINAE-KOVSQTEASA-L |
| XLogP | 4.32 |
| TPSA | 44.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|