C28H26N2O2 — CID 137032211
2-[[8-[(2-hydroxy-3,5-dimethylphenyl)methylideneamino]naphthalen-1-yl]iminomethyl]-4,6-dimethylphenol (PubChem CID 137032211) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[[8-[(2-hydroxy-3,5-dimethylphenyl)methylideneamino]naphthalen-1-yl]iminomethyl]-4,6-dimethylphenol.
| Compound Name | 2-[[8-[(2-hydroxy-3,5-dimethylphenyl)methylideneamino]naphthalen-1-yl]iminomethyl]-4,6-dimethylphenol |
|---|---|
| PubChem CID | 137032211 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[[8-[(2-hydroxy-3,5-dimethylphenyl)methylideneamino]naphthalen-1-yl]iminomethyl]-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c(/C=N\c2cccc3cccc(/N=C/c4cc(C)cc(C)c4O)c23)c1 |
| InChI | InChI=1S/C28H26N2O2/c1-17-11-19(3)27(31)22(13-17)15-29-24-9-5-7-21-8-6-10-25(26(21)24)30-16-23-14-18(2)12-20(4)28(23)32/h5-16,31-32H,1-4H3/b29-15-,30-16+ |
| InChIKey | KULDTPPARMNGCU-CBTGBURPSA-N |
| XLogP | 6.99 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|