C34H24N2O4 — CID 136596197
1-[2-hydroxy-3-[(2-hydroxyphenyl)iminomethyl]naphthalen-1-yl]-3-[(2-hydroxyphenyl)iminomethyl]naphthalen-2-ol (PubChem CID 136596197) has the molecular formula C34H24N2O4 and a molecular weight of 524.58 g/mol. Its IUPAC name is 1-[2-hydroxy-3-[(2-hydroxyphenyl)iminomethyl]naphthalen-1-yl]-3-[(2-hydroxyphenyl)iminomethyl]naphthalen-2-ol.
| Compound Name | 1-[2-hydroxy-3-[(2-hydroxyphenyl)iminomethyl]naphthalen-1-yl]-3-[(2-hydroxyphenyl)iminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 136596197 |
| Molecular Formula | C34H24N2O4 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 1-[2-hydroxy-3-[(2-hydroxyphenyl)iminomethyl]naphthalen-1-yl]-3-[(2-hydroxyphenyl)iminomethyl]naphthalen-2-ol |
| SMILES | Oc1ccccc1/N=C/c1cc2ccccc2c(-c2c(O)c(/C=N/c3ccccc3O)cc3ccccc23)c1O |
| InChI | InChI=1S/C34H24N2O4/c37-29-15-7-5-13-27(29)35-19-23-17-21-9-1-3-11-25(21)31(33(23)39)32-26-12-4-2-10-22(26)18-24(34(32)40)20-36-28-14-6-8-16-30(28)38/h1-20,37-40H/b35-19+,36-20+ |
| InChIKey | SDMYWCYHPQOVPY-CQFWSYKGSA-N |
| XLogP | 7.98 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|